C33H42N2O5 — CID 3621529
[2-[2-[2-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]pent-4-enoylamino]-2-phenylethyl] 2-benzylhex-5-enoate (PubChem CID 3621529) has the molecular formula C33H42N2O5 and a molecular weight of 546.71 g/mol. Its IUPAC name is [2-[2-[2-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]pent-4-enoylamino]-2-phenylethyl] 2-benzylhex-5-enoate.
| Compound Name | [2-[2-[2-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]pent-4-enoylamino]-2-phenylethyl] 2-benzylhex-5-enoate |
|---|---|
| PubChem CID | 3621529 |
| Molecular Formula | C33H42N2O5 |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | [2-[2-[2-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]pent-4-enoylamino]-2-phenylethyl] 2-benzylhex-5-enoate |
| SMILES | C=CCCC(Cc1ccccc1)C(=O)OCC(NC(=O)C(CC=C)CC(=O)N1CCCC1CO)c1ccccc1 |
| InChI | InChI=1S/C33H42N2O5/c1-3-5-16-28(21-25-14-8-6-9-15-25)33(39)40-24-30(26-17-10-7-11-18-26)34-32(38)27(13-4-2)22-31(37)35-20-12-19-29(35)23-36/h3-4,6-11,14-15,17-18,27-30,36H,1-2,5,12-13,16,19-24H2,(H,34,38) |
| InChIKey | BNRWVHLEBNYMMH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|