C34H44N2O5 — CID 6605479
[(2S)-1-[[(2R)-2-[2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]pent-4-enoyl]amino]propan-2-yl] (2R)-2-benzylhept-6-enoate (PubChem CID 6605479) has the molecular formula C34H44N2O5 and a molecular weight of 560.74 g/mol. Its IUPAC name is [(2S)-1-[[(2R)-2-[2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]pent-4-enoyl]amino]propan-2-yl] (2R)-2-benzylhept-6-enoate.
| Compound Name | [(2S)-1-[[(2R)-2-[2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]pent-4-enoyl]amino]propan-2-yl] (2R)-2-benzylhept-6-enoate |
|---|---|
| PubChem CID | 6605479 |
| Molecular Formula | C34H44N2O5 |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.33 |
| IUPAC Name | [(2S)-1-[[(2R)-2-[2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]pent-4-enoyl]amino]propan-2-yl] (2R)-2-benzylhept-6-enoate |
| SMILES | C=CCCC[C@H](Cc1ccccc1)C(=O)O[C@@H](C)CNC(=O)C(CC=C)CC(=O)N1Cc2ccccc2C[C@H]1CO |
| InChI | InChI=1S/C34H44N2O5/c1-4-6-8-17-29(19-26-14-9-7-10-15-26)34(40)41-25(3)22-35-33(39)28(13-5-2)21-32(38)36-23-30-18-12-11-16-27(30)20-31(36)24-37/h4-5,7,9-12,14-16,18,25,28-29,31,37H,1-2,6,8,13,17,19-24H2,3H3,(H,35,39)/t25-,28?,29+,31-/m0/s1 |
| InChIKey | OYVKRDLHGFXIDP-BFWLULERSA-N |
| XLogP | 4.78 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|