C29H44N2O5 — CID 3514675
[2-[2-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]pent-4-enoylamino]-3-methylbutyl] 2-benzylhept-6-enoate (PubChem CID 3514675) has the molecular formula C29H44N2O5 and a molecular weight of 500.68 g/mol. Its IUPAC name is [2-[2-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]pent-4-enoylamino]-3-methylbutyl] 2-benzylhept-6-enoate.
| Compound Name | [2-[2-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]pent-4-enoylamino]-3-methylbutyl] 2-benzylhept-6-enoate |
|---|---|
| PubChem CID | 3514675 |
| Molecular Formula | C29H44N2O5 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.33 |
| IUPAC Name | [2-[2-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]pent-4-enoylamino]-3-methylbutyl] 2-benzylhept-6-enoate |
| SMILES | C=CCCCC(Cc1ccccc1)C(=O)OCC(NC(=O)C(CC=C)CC(=O)NC(C)CO)C(C)C |
| InChI | InChI=1S/C29H44N2O5/c1-6-8-10-16-25(17-23-14-11-9-12-15-23)29(35)36-20-26(21(3)4)31-28(34)24(13-7-2)18-27(33)30-22(5)19-32/h6-7,9,11-12,14-15,21-22,24-26,32H,1-2,8,10,13,16-20H2,3-5H3,(H,30,33)(H,31,34) |
| InChIKey | MKTXEUAZJLQEEU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|