C33H44N2O6 — CID 4191994
[2-[2-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]pent-4-enoylamino]-3-phenylmethoxypropyl] 2-benzylhex-5-enoate (PubChem CID 4191994) has the molecular formula C33H44N2O6 and a molecular weight of 564.72 g/mol. Its IUPAC name is [2-[2-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]pent-4-enoylamino]-3-phenylmethoxypropyl] 2-benzylhex-5-enoate.
| Compound Name | [2-[2-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]pent-4-enoylamino]-3-phenylmethoxypropyl] 2-benzylhex-5-enoate |
|---|---|
| PubChem CID | 4191994 |
| Molecular Formula | C33H44N2O6 |
| Molecular Weight | 564.72 g/mol |
| Exact Mass | 564.32 |
| IUPAC Name | [2-[2-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]pent-4-enoylamino]-3-phenylmethoxypropyl] 2-benzylhex-5-enoate |
| SMILES | C=CCCC(Cc1ccccc1)C(=O)OCC(COCc1ccccc1)NC(=O)C(CC=C)CC(=O)NC(C)CO |
| InChI | InChI=1S/C33H44N2O6/c1-4-6-18-29(19-26-14-9-7-10-15-26)33(39)41-24-30(23-40-22-27-16-11-8-12-17-27)35-32(38)28(13-5-2)20-31(37)34-25(3)21-36/h4-5,7-12,14-17,25,28-30,36H,1-2,6,13,18-24H2,3H3,(H,34,37)(H,35,38) |
| InChIKey | HOVSCUIJGMKGJK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.72 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|