C34H44N2O7 — CID 3262799
[2-[2-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]pent-4-enoylamino]-3-oxo-3-phenylmethoxypropyl] 2-benzylhept-6-enoate (PubChem CID 3262799) has the molecular formula C34H44N2O7 and a molecular weight of 592.73 g/mol. Its IUPAC name is [2-[2-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]pent-4-enoylamino]-3-oxo-3-phenylmethoxypropyl] 2-benzylhept-6-enoate.
| Compound Name | [2-[2-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]pent-4-enoylamino]-3-oxo-3-phenylmethoxypropyl] 2-benzylhept-6-enoate |
|---|---|
| PubChem CID | 3262799 |
| Molecular Formula | C34H44N2O7 |
| Molecular Weight | 592.73 g/mol |
| Exact Mass | 592.31 |
| IUPAC Name | [2-[2-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]pent-4-enoylamino]-3-oxo-3-phenylmethoxypropyl] 2-benzylhept-6-enoate |
| SMILES | C=CCCCC(Cc1ccccc1)C(=O)OCC(NC(=O)C(CC=C)CC(=O)NC(C)CO)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H44N2O7/c1-4-6-9-19-29(20-26-15-10-7-11-16-26)33(40)43-24-30(34(41)42-23-27-17-12-8-13-18-27)36-32(39)28(14-5-2)21-31(38)35-25(3)22-37/h4-5,7-8,10-13,15-18,25,28-30,37H,1-2,6,9,14,19-24H2,3H3,(H,35,38)(H,36,39) |
| InChIKey | MPFNHWLRPIJJDL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.73 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|