C38H46N2O5 — CID 6607336
[(2R)-2-[[(2R)-2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoyl]amino]-3-phenylpropyl] (2R)-2-benzylhex-5-enoate (PubChem CID 6607336) has the molecular formula C38H46N2O5 and a molecular weight of 610.80 g/mol. Its IUPAC name is [(2R)-2-[[(2R)-2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoyl]amino]-3-phenylpropyl] (2R)-2-benzylhex-5-enoate.
| Compound Name | [(2R)-2-[[(2R)-2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoyl]amino]-3-phenylpropyl] (2R)-2-benzylhex-5-enoate |
|---|---|
| PubChem CID | 6607336 |
| Molecular Formula | C38H46N2O5 |
| Molecular Weight | 610.80 g/mol |
| Exact Mass | 610.34 |
| IUPAC Name | [(2R)-2-[[(2R)-2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoyl]amino]-3-phenylpropyl] (2R)-2-benzylhex-5-enoate |
| SMILES | C=CCC[C@H](Cc1ccccc1)C(=O)OC[C@@H](Cc1ccccc1)NC(=O)[C@H](CC=C)CC(=O)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C38H46N2O5/c1-3-5-22-34(25-30-16-9-6-10-17-30)38(44)45-29-35(26-31-18-11-7-12-19-31)39-37(43)33(15-4-2)27-36(42)40(23-24-41)28-32-20-13-8-14-21-32/h3-4,6-14,16-21,33-35,41H,1-2,5,15,22-29H2,(H,39,43)/t33-,34-,35-/m1/s1 |
| InChIKey | YXORPVHQYCFPCL-YAFWASLJSA-N |
| XLogP | 5.69 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.80 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|