C24H37N3O6 — CID 5064008
benzyl N-[6-hydroxy-5-[2-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]pent-4-enoylamino]hexyl]carbamate (PubChem CID 5064008) has the molecular formula C24H37N3O6 and a molecular weight of 463.58 g/mol. Its IUPAC name is benzyl N-[6-hydroxy-5-[2-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]pent-4-enoylamino]hexyl]carbamate.
| Compound Name | benzyl N-[6-hydroxy-5-[2-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]pent-4-enoylamino]hexyl]carbamate |
|---|---|
| PubChem CID | 5064008 |
| Molecular Formula | C24H37N3O6 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | benzyl N-[6-hydroxy-5-[2-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]pent-4-enoylamino]hexyl]carbamate |
| SMILES | C=CCC(CC(=O)NC(C)CO)C(=O)NC(CO)CCCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H37N3O6/c1-3-9-20(14-22(30)26-18(2)15-28)23(31)27-21(16-29)12-7-8-13-25-24(32)33-17-19-10-5-4-6-11-19/h3-6,10-11,18,20-21,28-29H,1,7-9,12-17H2,2H3,(H,25,32)(H,26,30)(H,27,31) |
| InChIKey | DVNUPXHXKCFVEP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 136.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|