C26H39N3O6 — CID 4605591
benzyl N-[6-hydroxy-5-[2-[2-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]pent-4-enoylamino]hexyl]carbamate (PubChem CID 4605591) has the molecular formula C26H39N3O6 and a molecular weight of 489.61 g/mol. Its IUPAC name is benzyl N-[6-hydroxy-5-[2-[2-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]pent-4-enoylamino]hexyl]carbamate.
| Compound Name | benzyl N-[6-hydroxy-5-[2-[2-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]pent-4-enoylamino]hexyl]carbamate |
|---|---|
| PubChem CID | 4605591 |
| Molecular Formula | C26H39N3O6 |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.28 |
| IUPAC Name | benzyl N-[6-hydroxy-5-[2-[2-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]pent-4-enoylamino]hexyl]carbamate |
| SMILES | C=CCC(CC(=O)N1CCCC1CO)C(=O)NC(CO)CCCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H39N3O6/c1-2-9-21(16-24(32)29-15-8-13-23(29)18-31)25(33)28-22(17-30)12-6-7-14-27-26(34)35-19-20-10-4-3-5-11-20/h2-5,10-11,21-23,30-31H,1,6-9,12-19H2,(H,27,34)(H,28,33) |
| InChIKey | NMIIRZRZJBZIGC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|