C39H48N2O7 — CID 4573063
[2-[2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoylamino]-3-(4-phenylmethoxyphenyl)propyl] 2-benzylpent-4-enoate (PubChem CID 4573063) has the molecular formula C39H48N2O7 and a molecular weight of 656.82 g/mol. Its IUPAC name is [2-[2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoylamino]-3-(4-phenylmethoxyphenyl)propyl] 2-benzylpent-4-enoate.
| Compound Name | [2-[2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoylamino]-3-(4-phenylmethoxyphenyl)propyl] 2-benzylpent-4-enoate |
|---|---|
| PubChem CID | 4573063 |
| Molecular Formula | C39H48N2O7 |
| Molecular Weight | 656.82 g/mol |
| Exact Mass | 656.35 |
| IUPAC Name | [2-[2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoylamino]-3-(4-phenylmethoxyphenyl)propyl] 2-benzylpent-4-enoate |
| SMILES | C=CCC(CC(=O)NCCOCCO)C(=O)NC(COC(=O)C(CC=C)Cc1ccccc1)Cc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C39H48N2O7/c1-3-11-33(27-37(43)40-21-23-46-24-22-42)38(44)41-35(29-48-39(45)34(12-4-2)25-30-13-7-5-8-14-30)26-31-17-19-36(20-18-31)47-28-32-15-9-6-10-16-32/h3-10,13-20,33-35,42H,1-2,11-12,21-29H2,(H,40,43)(H,41,44) |
| InChIKey | HIDWPMIKDVAGSV-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.82 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|