C31H40N2O6 — CID 4639736
[2-[2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoylamino]-1-phenylethyl] 2-benzylpent-4-enoate (PubChem CID 4639736) has the molecular formula C31H40N2O6 and a molecular weight of 536.67 g/mol. Its IUPAC name is [2-[2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoylamino]-1-phenylethyl] 2-benzylpent-4-enoate.
| Compound Name | [2-[2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoylamino]-1-phenylethyl] 2-benzylpent-4-enoate |
|---|---|
| PubChem CID | 4639736 |
| Molecular Formula | C31H40N2O6 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.29 |
| IUPAC Name | [2-[2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoylamino]-1-phenylethyl] 2-benzylpent-4-enoate |
| SMILES | C=CCC(CC(=O)NCCOCCO)C(=O)NCC(OC(=O)C(CC=C)Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H40N2O6/c1-3-11-26(22-29(35)32-17-19-38-20-18-34)30(36)33-23-28(25-15-9-6-10-16-25)39-31(37)27(12-4-2)21-24-13-7-5-8-14-24/h3-10,13-16,26-28,34H,1-2,11-12,17-23H2,(H,32,35)(H,33,36) |
| InChIKey | ICDHMJAPQZLHFH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|