C29H42N2O6 — CID 135739158
[1-[[(2S)-2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoyl]amino]cyclopentyl]methyl (2S)-2-benzylpent-4-enoate (PubChem CID 135739158) has the molecular formula C29H42N2O6 and a molecular weight of 514.66 g/mol. Its IUPAC name is [1-[[(2S)-2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoyl]amino]cyclopentyl]methyl (2S)-2-benzylpent-4-enoate.
| Compound Name | [1-[[(2S)-2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoyl]amino]cyclopentyl]methyl (2S)-2-benzylpent-4-enoate |
|---|---|
| PubChem CID | 135739158 |
| Molecular Formula | C29H42N2O6 |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.30 |
| IUPAC Name | [1-[[(2S)-2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoyl]amino]cyclopentyl]methyl (2S)-2-benzylpent-4-enoate |
| SMILES | C=CC[C@@H](CC(=O)NCCOCCO)C(=O)NC1(COC(=O)[C@@H](CC=C)Cc2ccccc2)CCCC1 |
| InChI | InChI=1S/C29H42N2O6/c1-3-10-24(21-26(33)30-16-18-36-19-17-32)27(34)31-29(14-8-9-15-29)22-37-28(35)25(11-4-2)20-23-12-6-5-7-13-23/h3-7,12-13,24-25,32H,1-2,8-11,14-22H2,(H,30,33)(H,31,34)/t24-,25-/m0/s1 |
| InChIKey | DDKXPRMJBPWMJT-DQEYMECFSA-N |
| XLogP | 3.10 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|