C19H28N2O5 — CID 3635683
N'-[2-(2-hydroxyethoxy)ethyl]-N-(2-hydroxy-2-phenylethyl)-2-prop-2-enylbutanediamide (PubChem CID 3635683) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is N'-[2-(2-hydroxyethoxy)ethyl]-N-(2-hydroxy-2-phenylethyl)-2-prop-2-enylbutanediamide.
| Compound Name | N'-[2-(2-hydroxyethoxy)ethyl]-N-(2-hydroxy-2-phenylethyl)-2-prop-2-enylbutanediamide |
|---|---|
| PubChem CID | 3635683 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | N'-[2-(2-hydroxyethoxy)ethyl]-N-(2-hydroxy-2-phenylethyl)-2-prop-2-enylbutanediamide |
| SMILES | C=CCC(CC(=O)NCCOCCO)C(=O)NCC(O)c1ccccc1 |
| InChI | InChI=1S/C19H28N2O5/c1-2-6-16(13-18(24)20-9-11-26-12-10-22)19(25)21-14-17(23)15-7-4-3-5-8-15/h2-5,7-8,16-17,22-23H,1,6,9-14H2,(H,20,24)(H,21,25) |
| InChIKey | AWFXTZBDEDUUIC-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|