C18H26N2O4 — CID 6607558
(2R)-N-[(2R)-2-hydroxy-2-phenylethyl]-N'-[(2R)-1-hydroxypropan-2-yl]-2-prop-2-enylbutanediamide (PubChem CID 6607558) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is (2R)-N-[(2R)-2-hydroxy-2-phenylethyl]-N'-[(2R)-1-hydroxypropan-2-yl]-2-prop-2-enylbutanediamide.
| Compound Name | (2R)-N-[(2R)-2-hydroxy-2-phenylethyl]-N'-[(2R)-1-hydroxypropan-2-yl]-2-prop-2-enylbutanediamide |
|---|---|
| PubChem CID | 6607558 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | (2R)-N-[(2R)-2-hydroxy-2-phenylethyl]-N'-[(2R)-1-hydroxypropan-2-yl]-2-prop-2-enylbutanediamide |
| SMILES | C=CC[C@H](CC(=O)N[C@H](C)CO)C(=O)NC[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C18H26N2O4/c1-3-7-15(10-17(23)20-13(2)12-21)18(24)19-11-16(22)14-8-5-4-6-9-14/h3-6,8-9,13,15-16,21-22H,1,7,10-12H2,2H3,(H,19,24)(H,20,23)/t13-,15-,16+/m1/s1 |
| InChIKey | YXKMGYAZCZLBDI-BMFZPTHFSA-N |
| XLogP | 0.92 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|