C20H22ClNO2 — CID 118867192
(2S)-2-[(4-chlorophenyl)methyl]-N-[(2R)-2-hydroxy-2-phenylethyl]pent-4-enamide (PubChem CID 118867192) has the molecular formula C20H22ClNO2 and a molecular weight of 343.85 g/mol. Its IUPAC name is (2S)-2-[(4-chlorophenyl)methyl]-N-[(2R)-2-hydroxy-2-phenylethyl]pent-4-enamide.
| Compound Name | (2S)-2-[(4-chlorophenyl)methyl]-N-[(2R)-2-hydroxy-2-phenylethyl]pent-4-enamide |
|---|---|
| PubChem CID | 118867192 |
| Molecular Formula | C20H22ClNO2 |
| Molecular Weight | 343.85 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | (2S)-2-[(4-chlorophenyl)methyl]-N-[(2R)-2-hydroxy-2-phenylethyl]pent-4-enamide |
| SMILES | C=CC[C@@H](Cc1ccc(Cl)cc1)C(=O)NC[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C20H22ClNO2/c1-2-6-17(13-15-9-11-18(21)12-10-15)20(24)22-14-19(23)16-7-4-3-5-8-16/h2-5,7-12,17,19,23H,1,6,13-14H2,(H,22,24)/t17-,19-/m0/s1 |
| InChIKey | CSTUYTRRYBQXDM-HKUYNNGSSA-N |
| XLogP | 3.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.85 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|