C22H25ClN2O2 — CID 143884038
N'-[(4-chlorophenyl)methyl]-N-(2-phenylethyl)-2-prop-2-enylbutanediamide (PubChem CID 143884038) has the molecular formula C22H25ClN2O2 and a molecular weight of 384.91 g/mol. Its IUPAC name is N'-[(4-chlorophenyl)methyl]-N-(2-phenylethyl)-2-prop-2-enylbutanediamide.
| Compound Name | N'-[(4-chlorophenyl)methyl]-N-(2-phenylethyl)-2-prop-2-enylbutanediamide |
|---|---|
| PubChem CID | 143884038 |
| Molecular Formula | C22H25ClN2O2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | N'-[(4-chlorophenyl)methyl]-N-(2-phenylethyl)-2-prop-2-enylbutanediamide |
| SMILES | C=CCC(CC(=O)NCc1ccc(Cl)cc1)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C22H25ClN2O2/c1-2-6-19(22(27)24-14-13-17-7-4-3-5-8-17)15-21(26)25-16-18-9-11-20(23)12-10-18/h2-5,7-12,19H,1,6,13-16H2,(H,24,27)(H,25,26) |
| InChIKey | FGVJHZGPYNJCEH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|