C30H38N2O5 — CID 4178311
[2-[2-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]pent-4-enoylamino]-1-phenylethyl] 2-benzylpent-4-enoate (PubChem CID 4178311) has the molecular formula C30H38N2O5 and a molecular weight of 506.64 g/mol. Its IUPAC name is [2-[2-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]pent-4-enoylamino]-1-phenylethyl] 2-benzylpent-4-enoate.
| Compound Name | [2-[2-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]pent-4-enoylamino]-1-phenylethyl] 2-benzylpent-4-enoate |
|---|---|
| PubChem CID | 4178311 |
| Molecular Formula | C30H38N2O5 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | [2-[2-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]pent-4-enoylamino]-1-phenylethyl] 2-benzylpent-4-enoate |
| SMILES | C=CCC(CC(=O)NC(C)CO)C(=O)NCC(OC(=O)C(CC=C)Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H38N2O5/c1-4-12-25(19-28(34)32-22(3)21-33)29(35)31-20-27(24-16-10-7-11-17-24)37-30(36)26(13-5-2)18-23-14-8-6-9-15-23/h4-11,14-17,22,25-27,33H,1-2,12-13,18-21H2,3H3,(H,31,35)(H,32,34) |
| InChIKey | DUNQPCITEXLWSI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|