C33H44N2O6 — CID 6607407
[(1S)-2-[[(2R)-2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoyl]amino]-1-phenylethyl] (2R)-2-benzylhept-6-enoate (PubChem CID 6607407) has the molecular formula C33H44N2O6 and a molecular weight of 564.72 g/mol. Its IUPAC name is [(1S)-2-[[(2R)-2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoyl]amino]-1-phenylethyl] (2R)-2-benzylhept-6-enoate.
| Compound Name | [(1S)-2-[[(2R)-2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoyl]amino]-1-phenylethyl] (2R)-2-benzylhept-6-enoate |
|---|---|
| PubChem CID | 6607407 |
| Molecular Formula | C33H44N2O6 |
| Molecular Weight | 564.72 g/mol |
| Exact Mass | 564.32 |
| IUPAC Name | [(1S)-2-[[(2R)-2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoyl]amino]-1-phenylethyl] (2R)-2-benzylhept-6-enoate |
| SMILES | C=CCCC[C@H](Cc1ccccc1)C(=O)O[C@H](CNC(=O)C(CC=C)CC(=O)NCCOCCO)c1ccccc1 |
| InChI | InChI=1S/C33H44N2O6/c1-3-5-8-18-29(23-26-14-9-6-10-15-26)33(39)41-30(27-16-11-7-12-17-27)25-35-32(38)28(13-4-2)24-31(37)34-19-21-40-22-20-36/h3-4,6-7,9-12,14-17,28-30,36H,1-2,5,8,13,18-25H2,(H,34,37)(H,35,38)/t28?,29-,30-/m1/s1 |
| InChIKey | XWYICDVUUMQTCR-GVKMRLRKSA-N |
| XLogP | 4.31 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.72 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|