C28H41N3O8 — CID 3599196
[2-[2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoylamino]-2-methylpropyl] 2-(phenylmethoxycarbonylamino)pent-4-enoate (PubChem CID 3599196) has the molecular formula C28H41N3O8 and a molecular weight of 547.65 g/mol. Its IUPAC name is [2-[2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoylamino]-2-methylpropyl] 2-(phenylmethoxycarbonylamino)pent-4-enoate.
| Compound Name | [2-[2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoylamino]-2-methylpropyl] 2-(phenylmethoxycarbonylamino)pent-4-enoate |
|---|---|
| PubChem CID | 3599196 |
| Molecular Formula | C28H41N3O8 |
| Molecular Weight | 547.65 g/mol |
| Exact Mass | 547.29 |
| IUPAC Name | [2-[2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoylamino]-2-methylpropyl] 2-(phenylmethoxycarbonylamino)pent-4-enoate |
| SMILES | C=CCC(CC(=O)NCCOCCO)C(=O)NC(C)(C)COC(=O)C(CC=C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H41N3O8/c1-5-10-22(18-24(33)29-14-16-37-17-15-32)25(34)31-28(3,4)20-39-26(35)23(11-6-2)30-27(36)38-19-21-12-8-7-9-13-21/h5-9,12-13,22-23,32H,1-2,10-11,14-20H2,3-4H3,(H,29,33)(H,30,36)(H,31,34) |
| InChIKey | RTTYJKBOXFQRQB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.65 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|