C22H38N2O6 — CID 135961056
[2-[[(2S)-2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoyl]amino]-2-methylpropyl] hept-6-enoate (PubChem CID 135961056) has the molecular formula C22H38N2O6 and a molecular weight of 426.55 g/mol. Its IUPAC name is [2-[[(2S)-2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoyl]amino]-2-methylpropyl] hept-6-enoate.
| Compound Name | [2-[[(2S)-2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoyl]amino]-2-methylpropyl] hept-6-enoate |
|---|---|
| PubChem CID | 135961056 |
| Molecular Formula | C22H38N2O6 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | [2-[[(2S)-2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoyl]amino]-2-methylpropyl] hept-6-enoate |
| SMILES | C=CCCCCC(=O)OCC(C)(C)NC(=O)[C@@H](CC=C)CC(=O)NCCOCCO |
| InChI | InChI=1S/C22H38N2O6/c1-5-7-8-9-11-20(27)30-17-22(3,4)24-21(28)18(10-6-2)16-19(26)23-12-14-29-15-13-25/h5-6,18,25H,1-2,7-17H2,3-4H3,(H,23,26)(H,24,28)/t18-/m0/s1 |
| InChIKey | WRIMXWSYJQIGTA-SFHVURJKSA-N |
| XLogP | 1.88 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|