C16H30N2O5 — CID 4074038
N'-[2-(2-hydroxyethoxy)ethyl]-N-(1-hydroxy-3-methylbutan-2-yl)-2-prop-2-enylbutanediamide (PubChem CID 4074038) has the molecular formula C16H30N2O5 and a molecular weight of 330.43 g/mol. Its IUPAC name is N'-[2-(2-hydroxyethoxy)ethyl]-N-(1-hydroxy-3-methylbutan-2-yl)-2-prop-2-enylbutanediamide.
| Compound Name | N'-[2-(2-hydroxyethoxy)ethyl]-N-(1-hydroxy-3-methylbutan-2-yl)-2-prop-2-enylbutanediamide |
|---|---|
| PubChem CID | 4074038 |
| Molecular Formula | C16H30N2O5 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | N'-[2-(2-hydroxyethoxy)ethyl]-N-(1-hydroxy-3-methylbutan-2-yl)-2-prop-2-enylbutanediamide |
| SMILES | C=CCC(CC(=O)NCCOCCO)C(=O)NC(CO)C(C)C |
| InChI | InChI=1S/C16H30N2O5/c1-4-5-13(16(22)18-14(11-20)12(2)3)10-15(21)17-6-8-23-9-7-19/h4,12-14,19-20H,1,5-11H2,2-3H3,(H,17,21)(H,18,22) |
| InChIKey | BIDGUTFHZAIQHO-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|