C22H31N3O5 — CID 24893030
(2S)-N'-[2-(2-hydroxyethoxy)ethyl]-N-[(2S)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]-2-prop-2-enylbutanediamide (PubChem CID 24893030) has the molecular formula C22H31N3O5 and a molecular weight of 417.51 g/mol. Its IUPAC name is (2S)-N'-[2-(2-hydroxyethoxy)ethyl]-N-[(2S)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]-2-prop-2-enylbutanediamide.
| Compound Name | (2S)-N'-[2-(2-hydroxyethoxy)ethyl]-N-[(2S)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]-2-prop-2-enylbutanediamide |
|---|---|
| PubChem CID | 24893030 |
| Molecular Formula | C22H31N3O5 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | (2S)-N'-[2-(2-hydroxyethoxy)ethyl]-N-[(2S)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]-2-prop-2-enylbutanediamide |
| SMILES | C=CC[C@@H](CC(=O)NCCOCCO)C(=O)N[C@H](CO)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H31N3O5/c1-2-5-16(13-21(28)23-8-10-30-11-9-26)22(29)25-18(15-27)12-17-14-24-20-7-4-3-6-19(17)20/h2-4,6-7,14,16,18,24,26-27H,1,5,8-13,15H2,(H,23,28)(H,25,29)/t16-,18-/m0/s1 |
| InChIKey | KVGZPXZRAAZPCB-WMZOPIPTSA-N |
| XLogP | 0.89 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|