C32H39N3O5 — CID 4998834
[2-[2-[2-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-oxoethyl]pent-4-enoylamino]-3-(1H-indol-3-yl)propyl] pent-4-enoate (PubChem CID 4998834) has the molecular formula C32H39N3O5 and a molecular weight of 545.68 g/mol. Its IUPAC name is [2-[2-[2-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-oxoethyl]pent-4-enoylamino]-3-(1H-indol-3-yl)propyl] pent-4-enoate.
| Compound Name | [2-[2-[2-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-oxoethyl]pent-4-enoylamino]-3-(1H-indol-3-yl)propyl] pent-4-enoate |
|---|---|
| PubChem CID | 4998834 |
| Molecular Formula | C32H39N3O5 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.29 |
| IUPAC Name | [2-[2-[2-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-oxoethyl]pent-4-enoylamino]-3-(1H-indol-3-yl)propyl] pent-4-enoate |
| SMILES | C=CCCC(=O)OCC(Cc1c[nH]c2ccccc12)NC(=O)C(CC=C)CC(=O)NC(CO)Cc1ccccc1 |
| InChI | InChI=1S/C32H39N3O5/c1-3-5-16-31(38)40-22-27(18-25-20-33-29-15-10-9-14-28(25)29)35-32(39)24(11-4-2)19-30(37)34-26(21-36)17-23-12-7-6-8-13-23/h3-4,6-10,12-15,20,24,26-27,33,36H,1-2,5,11,16-19,21-22H2,(H,34,37)(H,35,39) |
| InChIKey | FDEJEZXIMRIWJO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|