C48H52N4O7 — CID 5085299
[2-[2-[2-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-oxoethyl]pent-4-enoylamino]-3-(1H-indol-3-yl)propyl] 2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoate (PubChem CID 5085299) has the molecular formula C48H52N4O7 and a molecular weight of 796.96 g/mol. Its IUPAC name is [2-[2-[2-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-oxoethyl]pent-4-enoylamino]-3-(1H-indol-3-yl)propyl] 2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoate.
| Compound Name | [2-[2-[2-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-oxoethyl]pent-4-enoylamino]-3-(1H-indol-3-yl)propyl] 2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoate |
|---|---|
| PubChem CID | 5085299 |
| Molecular Formula | C48H52N4O7 |
| Molecular Weight | 796.96 g/mol |
| Exact Mass | 796.38 |
| IUPAC Name | [2-[2-[2-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-oxoethyl]pent-4-enoylamino]-3-(1H-indol-3-yl)propyl] 2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoate |
| SMILES | C=CCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OCC(Cc1c[nH]c2ccccc12)NC(=O)C(CC=C)CC(=O)NC(CO)Cc1ccccc1 |
| InChI | InChI=1S/C48H52N4O7/c1-3-5-23-44(52-48(57)59-31-42-40-21-11-9-19-38(40)39-20-10-12-22-41(39)42)47(56)58-30-36(26-34-28-49-43-24-14-13-18-37(34)43)51-46(55)33(15-4-2)27-45(54)50-35(29-53)25-32-16-7-6-8-17-32/h3-4,6-14,16-22,24,28,33,35-36,42,44,49,53H,1-2,5,15,23,25-27,29-31H2,(H,50,54)(H,51,55)(H,52,57) |
| InChIKey | KWZUTWZPGVZNJN-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 158.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.96 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|