C40H47N3O7 — CID 6605564
[(2S)-2-[[(2R)-2-[2-[[(2R)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]-3-phenylpropyl] (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoate (PubChem CID 6605564) has the molecular formula C40H47N3O7 and a molecular weight of 681.83 g/mol. Its IUPAC name is [(2S)-2-[[(2R)-2-[2-[[(2R)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]-3-phenylpropyl] (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoate.
| Compound Name | [(2S)-2-[[(2R)-2-[2-[[(2R)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]-3-phenylpropyl] (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoate |
|---|---|
| PubChem CID | 6605564 |
| Molecular Formula | C40H47N3O7 |
| Molecular Weight | 681.83 g/mol |
| Exact Mass | 681.34 |
| IUPAC Name | [(2S)-2-[[(2R)-2-[2-[[(2R)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]-3-phenylpropyl] (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoate |
| SMILES | C=CCC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OC[C@H](Cc1ccccc1)NC(=O)[C@H](CC=C)CC(=O)N[C@H](C)CO |
| InChI | InChI=1S/C40H47N3O7/c1-4-6-21-36(43-40(48)50-26-35-33-19-12-10-17-31(33)32-18-11-13-20-34(32)35)39(47)49-25-30(22-28-15-8-7-9-16-28)42-38(46)29(14-5-2)23-37(45)41-27(3)24-44/h4-5,7-13,15-20,27,29-30,35-36,44H,1-2,6,14,21-26H2,3H3,(H,41,45)(H,42,46)(H,43,48)/t27-,29-,30+,36+/m1/s1 |
| InChIKey | DYXUBNZIUHPXHO-ZYEHEDBRSA-N |
| XLogP | 5.21 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.83 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|