C41H47N3O9 — CID 4185610
[2-[2-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]pent-4-enoylamino]-3-oxo-3-phenylmethoxypropyl] 2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoate (PubChem CID 4185610) has the molecular formula C41H47N3O9 and a molecular weight of 725.84 g/mol. Its IUPAC name is [2-[2-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]pent-4-enoylamino]-3-oxo-3-phenylmethoxypropyl] 2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoate.
| Compound Name | [2-[2-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]pent-4-enoylamino]-3-oxo-3-phenylmethoxypropyl] 2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoate |
|---|---|
| PubChem CID | 4185610 |
| Molecular Formula | C41H47N3O9 |
| Molecular Weight | 725.84 g/mol |
| Exact Mass | 725.33 |
| IUPAC Name | [2-[2-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]pent-4-enoylamino]-3-oxo-3-phenylmethoxypropyl] 2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoate |
| SMILES | C=CCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OCC(NC(=O)C(CC=C)CC(=O)NC(C)CO)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C41H47N3O9/c1-4-6-21-35(44-41(50)53-25-34-32-19-12-10-17-30(32)31-18-11-13-20-33(31)34)39(48)52-26-36(40(49)51-24-28-15-8-7-9-16-28)43-38(47)29(14-5-2)22-37(46)42-27(3)23-45/h4-5,7-13,15-20,27,29,34-36,45H,1-2,6,14,21-26H2,3H3,(H,42,46)(H,43,47)(H,44,50) |
| InChIKey | FCUVEYOOHCRZMY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 169.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.84 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|