C44H48N4O8 — CID 4076447
[2-[2-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]pent-4-enoylamino]-3-(naphthalen-2-ylamino)-3-oxopropyl] 2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoate (PubChem CID 4076447) has the molecular formula C44H48N4O8 and a molecular weight of 760.89 g/mol. Its IUPAC name is [2-[2-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]pent-4-enoylamino]-3-(naphthalen-2-ylamino)-3-oxopropyl] 2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoate.
| Compound Name | [2-[2-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]pent-4-enoylamino]-3-(naphthalen-2-ylamino)-3-oxopropyl] 2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoate |
|---|---|
| PubChem CID | 4076447 |
| Molecular Formula | C44H48N4O8 |
| Molecular Weight | 760.89 g/mol |
| Exact Mass | 760.35 |
| IUPAC Name | [2-[2-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]pent-4-enoylamino]-3-(naphthalen-2-ylamino)-3-oxopropyl] 2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoate |
| SMILES | C=CCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OCC(NC(=O)C(CC=C)CC(=O)NC(C)CO)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C44H48N4O8/c1-4-6-20-38(48-44(54)56-26-37-35-18-11-9-16-33(35)34-17-10-12-19-36(34)37)43(53)55-27-39(42(52)46-32-22-21-29-14-7-8-15-30(29)23-32)47-41(51)31(13-5-2)24-40(50)45-28(3)25-49/h4-5,7-12,14-19,21-23,28,31,37-39,49H,1-2,6,13,20,24-27H2,3H3,(H,45,50)(H,46,52)(H,47,51)(H,48,54) |
| InChIKey | USJBETSISWHCCG-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 172.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.89 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|