C50H52N4O8 — CID 4591863
[2-[2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoylamino]-3-(naphthalen-2-ylamino)-3-oxopropyl] 2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoate (PubChem CID 4591863) has the molecular formula C50H52N4O8 and a molecular weight of 836.99 g/mol. Its IUPAC name is [2-[2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoylamino]-3-(naphthalen-2-ylamino)-3-oxopropyl] 2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoate.
| Compound Name | [2-[2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoylamino]-3-(naphthalen-2-ylamino)-3-oxopropyl] 2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoate |
|---|---|
| PubChem CID | 4591863 |
| Molecular Formula | C50H52N4O8 |
| Molecular Weight | 836.99 g/mol |
| Exact Mass | 836.38 |
| IUPAC Name | [2-[2-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]pent-4-enoylamino]-3-(naphthalen-2-ylamino)-3-oxopropyl] 2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoate |
| SMILES | C=CCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OCC(NC(=O)C(CC=C)CC(=O)N(CCO)Cc1ccccc1)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C50H52N4O8/c1-3-5-24-44(53-50(60)62-32-43-41-22-13-11-20-39(41)40-21-12-14-23-42(40)43)49(59)61-33-45(48(58)51-38-26-25-35-18-9-10-19-36(35)29-38)52-47(57)37(15-4-2)30-46(56)54(27-28-55)31-34-16-7-6-8-17-34/h3-4,6-14,16-23,25-26,29,37,43-45,55H,1-2,5,15,24,27-28,30-33H2,(H,51,58)(H,52,57)(H,53,60) |
| InChIKey | DOIQHLVELDAZTJ-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 163.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.99 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|