C39H45N3O7 — CID 23307381
2-[[(2S)-2-[2-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]ethyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoate (PubChem CID 23307381) has the molecular formula C39H45N3O7 and a molecular weight of 667.80 g/mol. Its IUPAC name is 2-[[(2S)-2-[2-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]ethyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoate.
| Compound Name | 2-[[(2S)-2-[2-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]ethyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoate |
|---|---|
| PubChem CID | 23307381 |
| Molecular Formula | C39H45N3O7 |
| Molecular Weight | 667.80 g/mol |
| Exact Mass | 667.33 |
| IUPAC Name | 2-[[(2S)-2-[2-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]amino]ethyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoate |
| SMILES | C=CCC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OCCNC(=O)[C@@H](CC=C)CC(=O)N[C@@H](CO)Cc1ccccc1 |
| InChI | InChI=1S/C39H45N3O7/c1-3-5-20-35(42-39(47)49-26-34-32-18-11-9-16-30(32)31-17-10-12-19-33(31)34)38(46)48-22-21-40-37(45)28(13-4-2)24-36(44)41-29(25-43)23-27-14-7-6-8-15-27/h3-4,6-12,14-19,28-29,34-35,43H,1-2,5,13,20-26H2,(H,40,45)(H,41,44)(H,42,47)/t28-,29+,35-/m0/s1 |
| InChIKey | CGTUUEPGVCIANT-AXJWHKOCSA-N |
| XLogP | 4.82 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.80 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|