C27H37N3O6 — CID 24893656
[(2S)-2-[[(2S)-2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoyl]amino]-3-(1H-indol-3-yl)propyl] pent-4-enoate (PubChem CID 24893656) has the molecular formula C27H37N3O6 and a molecular weight of 499.61 g/mol. Its IUPAC name is [(2S)-2-[[(2S)-2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoyl]amino]-3-(1H-indol-3-yl)propyl] pent-4-enoate.
| Compound Name | [(2S)-2-[[(2S)-2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoyl]amino]-3-(1H-indol-3-yl)propyl] pent-4-enoate |
|---|---|
| PubChem CID | 24893656 |
| Molecular Formula | C27H37N3O6 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | [(2S)-2-[[(2S)-2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoyl]amino]-3-(1H-indol-3-yl)propyl] pent-4-enoate |
| SMILES | C=CCCC(=O)OC[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](CC=C)CC(=O)NCCOCCO |
| InChI | InChI=1S/C27H37N3O6/c1-3-5-11-26(33)36-19-22(16-21-18-29-24-10-7-6-9-23(21)24)30-27(34)20(8-4-2)17-25(32)28-12-14-35-15-13-31/h3-4,6-7,9-10,18,20,22,29,31H,1-2,5,8,11-17,19H2,(H,28,32)(H,30,34)/t20-,22-/m0/s1 |
| InChIKey | CMVBUMVFYAXMLM-UNMCSNQZSA-N |
| XLogP | 2.41 |
| TPSA | 129.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|