C28H42N2O6S — CID 6606034
[(2R)-3-benzylsulfanyl-2-[[(2R)-2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoyl]amino]propyl] hept-6-enoate (PubChem CID 6606034) has the molecular formula C28H42N2O6S and a molecular weight of 534.72 g/mol. Its IUPAC name is [(2R)-3-benzylsulfanyl-2-[[(2R)-2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoyl]amino]propyl] hept-6-enoate.
| Compound Name | [(2R)-3-benzylsulfanyl-2-[[(2R)-2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoyl]amino]propyl] hept-6-enoate |
|---|---|
| PubChem CID | 6606034 |
| Molecular Formula | C28H42N2O6S |
| Molecular Weight | 534.72 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | [(2R)-3-benzylsulfanyl-2-[[(2R)-2-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]pent-4-enoyl]amino]propyl] hept-6-enoate |
| SMILES | C=CCCCCC(=O)OC[C@H](CSCc1ccccc1)NC(=O)[C@H](CC=C)CC(=O)NCCOCCO |
| InChI | InChI=1S/C28H42N2O6S/c1-3-5-6-10-14-27(33)36-20-25(22-37-21-23-12-8-7-9-13-23)30-28(34)24(11-4-2)19-26(32)29-15-17-35-18-16-31/h3-4,7-9,12-13,24-25,31H,1-2,5-6,10-11,14-22H2,(H,29,32)(H,30,34)/t24-,25-/m1/s1 |
| InChIKey | LGYDWKUMKLZHPE-JWQCQUIFSA-N |
| XLogP | 3.40 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.72 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|