C12H19N3O4S — CID 81082251
5-methoxy-2-[2-(1,3-thiazol-2-yl)ethylcarbamoylamino]pentanoic acid (PubChem CID 81082251) has the molecular formula C12H19N3O4S and a molecular weight of 301.37 g/mol. Its IUPAC name is 5-methoxy-2-[2-(1,3-thiazol-2-yl)ethylcarbamoylamino]pentanoic acid.
| Compound Name | 5-methoxy-2-[2-(1,3-thiazol-2-yl)ethylcarbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 81082251 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 5-methoxy-2-[2-(1,3-thiazol-2-yl)ethylcarbamoylamino]pentanoic acid |
| SMILES | COCCCC(NC(=O)NCCc1nccs1)C(=O)O |
| InChI | InChI=1S/C12H19N3O4S/c1-19-7-2-3-9(11(16)17)15-12(18)14-5-4-10-13-6-8-20-10/h6,8-9H,2-5,7H2,1H3,(H,16,17)(H2,14,15,18) |
| InChIKey | NVJXMMUZONJJBB-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|