C11H16N2O4S — CID 120702808
4-methoxy-2-[3-(1,3-thiazol-2-yl)propanoylamino]butanoic acid (PubChem CID 120702808) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is 4-methoxy-2-[3-(1,3-thiazol-2-yl)propanoylamino]butanoic acid.
| Compound Name | 4-methoxy-2-[3-(1,3-thiazol-2-yl)propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 120702808 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 4-methoxy-2-[3-(1,3-thiazol-2-yl)propanoylamino]butanoic acid |
| SMILES | COCCC(NC(=O)CCc1nccs1)C(=O)O |
| InChI | InChI=1S/C11H16N2O4S/c1-17-6-4-8(11(15)16)13-9(14)2-3-10-12-5-7-18-10/h5,7-8H,2-4,6H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | IBGBVCPTKHBTAP-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |