C12H18N2O3S — CID 119212051
3-methyl-2-[3-(1,3-thiazol-2-yl)propanoylamino]pentanoic acid (PubChem CID 119212051) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is 3-methyl-2-[3-(1,3-thiazol-2-yl)propanoylamino]pentanoic acid.
| Compound Name | 3-methyl-2-[3-(1,3-thiazol-2-yl)propanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 119212051 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 3-methyl-2-[3-(1,3-thiazol-2-yl)propanoylamino]pentanoic acid |
| SMILES | CCC(C)C(NC(=O)CCc1nccs1)C(=O)O |
| InChI | InChI=1S/C12H18N2O3S/c1-3-8(2)11(12(16)17)14-9(15)4-5-10-13-6-7-18-10/h6-8,11H,3-5H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | YVJCJSHSRMPCHX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |