C10H16N4O3 — CID 61209823
4-methyl-2-(1H-pyrazol-4-ylcarbamoylamino)pentanoic acid (PubChem CID 61209823) has the molecular formula C10H16N4O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is 4-methyl-2-(1H-pyrazol-4-ylcarbamoylamino)pentanoic acid.
| Compound Name | 4-methyl-2-(1H-pyrazol-4-ylcarbamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 61209823 |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 4-methyl-2-(1H-pyrazol-4-ylcarbamoylamino)pentanoic acid |
| SMILES | CC(C)CC(NC(=O)Nc1cn[nH]c1)C(=O)O |
| InChI | InChI=1S/C10H16N4O3/c1-6(2)3-8(9(15)16)14-10(17)13-7-4-11-12-5-7/h4-6,8H,3H2,1-2H3,(H,11,12)(H,15,16)(H2,13,14,17) |
| InChIKey | ATIXKUFDJPKPAN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |