C12H20N4O3 — CID 61209725
2-[(1-ethylpyrazol-4-yl)carbamoylamino]-4-methylpentanoic acid (PubChem CID 61209725) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-[(1-ethylpyrazol-4-yl)carbamoylamino]-4-methylpentanoic acid.
| Compound Name | 2-[(1-ethylpyrazol-4-yl)carbamoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 61209725 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 2-[(1-ethylpyrazol-4-yl)carbamoylamino]-4-methylpentanoic acid |
| SMILES | CCn1cc(NC(=O)NC(CC(C)C)C(=O)O)cn1 |
| InChI | InChI=1S/C12H20N4O3/c1-4-16-7-9(6-13-16)14-12(19)15-10(11(17)18)5-8(2)3/h6-8,10H,4-5H2,1-3H3,(H,17,18)(H2,14,15,19) |
| InChIKey | HSFCFXHBUYWAGE-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |