C10H16N4O4 — CID 104965883
(2S,3R)-2-[(1-ethylpyrazol-4-yl)carbamoylamino]-3-hydroxybutanoic acid (PubChem CID 104965883) has the molecular formula C10H16N4O4 and a molecular weight of 256.26 g/mol. Its IUPAC name is (2S,3R)-2-[(1-ethylpyrazol-4-yl)carbamoylamino]-3-hydroxybutanoic acid.
| Compound Name | (2S,3R)-2-[(1-ethylpyrazol-4-yl)carbamoylamino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 104965883 |
| Molecular Formula | C10H16N4O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | (2S,3R)-2-[(1-ethylpyrazol-4-yl)carbamoylamino]-3-hydroxybutanoic acid |
| SMILES | CCn1cc(NC(=O)N[C@H](C(=O)O)[C@@H](C)O)cn1 |
| InChI | InChI=1S/C10H16N4O4/c1-3-14-5-7(4-11-14)12-10(18)13-8(6(2)15)9(16)17/h4-6,8,15H,3H2,1-2H3,(H,16,17)(H2,12,13,18)/t6-,8+/m1/s1 |
| InChIKey | GKOKJNCVSZQRJH-SVRRBLITSA-N |
| XLogP | -0.14 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |