C20H29N3O8 — CID 102436642
(2S)-2-[[(2S)-6-amino-1-[(4-methoxyphenyl)methoxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioic acid (PubChem CID 102436642) has the molecular formula C20H29N3O8 and a molecular weight of 439.47 g/mol. Its IUPAC name is (2S)-2-[[(2S)-6-amino-1-[(4-methoxyphenyl)methoxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(2S)-6-amino-1-[(4-methoxyphenyl)methoxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 102436642 |
| Molecular Formula | C20H29N3O8 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | (2S)-2-[[(2S)-6-amino-1-[(4-methoxyphenyl)methoxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioic acid |
| SMILES | COc1ccc(COC(=O)[C@H](CCCCN)NC(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C20H29N3O8/c1-30-14-7-5-13(6-8-14)12-31-19(28)16(4-2-3-11-21)23-20(29)22-15(18(26)27)9-10-17(24)25/h5-8,15-16H,2-4,9-12,21H2,1H3,(H,24,25)(H,26,27)(H2,22,23,29)/t15-,16-/m0/s1 |
| InChIKey | QPKPWRXNLVFFFY-HOTGVXAUSA-N |
| XLogP | 0.85 |
| TPSA | 177.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|