C15H24N2O9 — CID 126702215
(2S)-2-[[(2S)-1-butoxy-4-carboxy-1-oxobutan-2-yl]carbamoylamino]pentanedioic acid (PubChem CID 126702215) has the molecular formula C15H24N2O9 and a molecular weight of 376.36 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1-butoxy-4-carboxy-1-oxobutan-2-yl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(2S)-1-butoxy-4-carboxy-1-oxobutan-2-yl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 126702215 |
| Molecular Formula | C15H24N2O9 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | (2S)-2-[[(2S)-1-butoxy-4-carboxy-1-oxobutan-2-yl]carbamoylamino]pentanedioic acid |
| SMILES | CCCCOC(=O)[C@H](CCC(=O)O)NC(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H24N2O9/c1-2-3-8-26-14(24)10(5-7-12(20)21)17-15(25)16-9(13(22)23)4-6-11(18)19/h9-10H,2-8H2,1H3,(H,18,19)(H,20,21)(H,22,23)(H2,16,17,25)/t9-,10-/m0/s1 |
| InChIKey | ZBRIRSXKQFCIAA-UWVGGRQHSA-N |
| XLogP | 0.18 |
| TPSA | 179.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|