C19H34N2O7 — CID 118070435
(4S)-5-butoxy-4-[[(2S)-1-butoxy-1-oxopentan-2-yl]carbamoylamino]-5-oxopentanoic acid (PubChem CID 118070435) has the molecular formula C19H34N2O7 and a molecular weight of 402.49 g/mol. Its IUPAC name is (4S)-5-butoxy-4-[[(2S)-1-butoxy-1-oxopentan-2-yl]carbamoylamino]-5-oxopentanoic acid.
| Compound Name | (4S)-5-butoxy-4-[[(2S)-1-butoxy-1-oxopentan-2-yl]carbamoylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 118070435 |
| Molecular Formula | C19H34N2O7 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | (4S)-5-butoxy-4-[[(2S)-1-butoxy-1-oxopentan-2-yl]carbamoylamino]-5-oxopentanoic acid |
| SMILES | CCCCOC(=O)[C@H](CCC)NC(=O)N[C@@H](CCC(=O)O)C(=O)OCCCC |
| InChI | InChI=1S/C19H34N2O7/c1-4-7-12-27-17(24)14(9-6-3)20-19(26)21-15(10-11-16(22)23)18(25)28-13-8-5-2/h14-15H,4-13H2,1-3H3,(H,22,23)(H2,20,21,26)/t14-,15-/m0/s1 |
| InChIKey | VIXBJTIKTWOBEU-GJZGRUSLSA-N |
| XLogP | 2.37 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|