C11H20N2O4 — CID 87112698
butyl (2S)-2-acetamido-5-amino-5-oxopentanoate (PubChem CID 87112698) has the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. Its IUPAC name is butyl (2S)-2-acetamido-5-amino-5-oxopentanoate.
| Compound Name | butyl (2S)-2-acetamido-5-amino-5-oxopentanoate |
|---|---|
| PubChem CID | 87112698 |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | butyl (2S)-2-acetamido-5-amino-5-oxopentanoate |
| SMILES | CCCCOC(=O)[C@H](CCC(N)=O)NC(C)=O |
| InChI | InChI=1S/C11H20N2O4/c1-3-4-7-17-11(16)9(13-8(2)14)5-6-10(12)15/h9H,3-7H2,1-2H3,(H2,12,15)(H,13,14)/t9-/m0/s1 |
| InChIKey | FKTAIWZNSXZRIS-VIFPVBQESA-N |
| XLogP | 0.10 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|