C17H30N2O4 — CID 21310250
3,7-dimethyloct-6-enyl (2S)-2-acetamido-5-amino-5-oxopentanoate (PubChem CID 21310250) has the molecular formula C17H30N2O4 and a molecular weight of 326.44 g/mol. Its IUPAC name is 3,7-dimethyloct-6-enyl (2S)-2-acetamido-5-amino-5-oxopentanoate.
| Compound Name | 3,7-dimethyloct-6-enyl (2S)-2-acetamido-5-amino-5-oxopentanoate |
|---|---|
| PubChem CID | 21310250 |
| Molecular Formula | C17H30N2O4 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 3,7-dimethyloct-6-enyl (2S)-2-acetamido-5-amino-5-oxopentanoate |
| SMILES | CC(=O)N[C@@H](CCC(N)=O)C(=O)OCCC(C)CCC=C(C)C |
| InChI | InChI=1S/C17H30N2O4/c1-12(2)6-5-7-13(3)10-11-23-17(22)15(19-14(4)20)8-9-16(18)21/h6,13,15H,5,7-11H2,1-4H3,(H2,18,21)(H,19,20)/t13?,15-/m0/s1 |
| InChIKey | HHLSCSJLNMIAKO-WUJWULDRSA-N |
| XLogP | 2.07 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|