C16H30N2O2S — CID 110180555
2-acetamido-4-(3,7-dimethyloct-6-enylsulfanyl)butanamide (PubChem CID 110180555) has the molecular formula C16H30N2O2S and a molecular weight of 314.50 g/mol. Its IUPAC name is 2-acetamido-4-(3,7-dimethyloct-6-enylsulfanyl)butanamide.
| Compound Name | 2-acetamido-4-(3,7-dimethyloct-6-enylsulfanyl)butanamide |
|---|---|
| PubChem CID | 110180555 |
| Molecular Formula | C16H30N2O2S |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 2-acetamido-4-(3,7-dimethyloct-6-enylsulfanyl)butanamide |
| SMILES | CC(=O)NC(CCSCCC(C)CCC=C(C)C)C(N)=O |
| InChI | InChI=1S/C16H30N2O2S/c1-12(2)6-5-7-13(3)8-10-21-11-9-15(16(17)20)18-14(4)19/h6,13,15H,5,7-11H2,1-4H3,(H2,17,20)(H,18,19) |
| InChIKey | ZXLUNYKCBHCQSY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|