C20H36N2O6 — CID 22215985
dibutyl (2S)-2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]pentanedioate (PubChem CID 22215985) has the molecular formula C20H36N2O6 and a molecular weight of 400.52 g/mol. Its IUPAC name is dibutyl (2S)-2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]pentanedioate.
| Compound Name | dibutyl (2S)-2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 22215985 |
| Molecular Formula | C20H36N2O6 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | dibutyl (2S)-2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]pentanedioate |
| SMILES | CCCCOC(=O)CC[C@H](NC(=O)[C@@H](NC(C)=O)C(C)C)C(=O)OCCCC |
| InChI | InChI=1S/C20H36N2O6/c1-6-8-12-27-17(24)11-10-16(20(26)28-13-9-7-2)22-19(25)18(14(3)4)21-15(5)23/h14,16,18H,6-13H2,1-5H3,(H,21,23)(H,22,25)/t16-,18-/m0/s1 |
| InChIKey | OHLPYPKZEDIARR-WMZOPIPTSA-N |
| XLogP | 2.10 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|