C37H66N4O13 — CID 164724922
dibutyl 2-[[4-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]-5-[(1,5-dibutoxy-1,5-dioxopentan-2-yl)amino]-5-oxopentanoyl]amino]pentanedioate (PubChem CID 164724922) has the molecular formula C37H66N4O13 and a molecular weight of 774.95 g/mol. Its IUPAC name is dibutyl 2-[[4-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]-5-[(1,5-dibutoxy-1,5-dioxopentan-2-yl)amino]-5-oxopentanoyl]amino]pentanedioate.
| Compound Name | dibutyl 2-[[4-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]-5-[(1,5-dibutoxy-1,5-dioxopentan-2-yl)amino]-5-oxopentanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 164724922 |
| Molecular Formula | C37H66N4O13 |
| Molecular Weight | 774.95 g/mol |
| Exact Mass | 774.46 |
| IUPAC Name | dibutyl 2-[[4-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]-5-[(1,5-dibutoxy-1,5-dioxopentan-2-yl)amino]-5-oxopentanoyl]amino]pentanedioate |
| SMILES | CCCCOC(=O)CCC(NC(=O)CCC(NC(=O)COCCOCCN)C(=O)NC(CCC(=O)OCCCC)C(=O)OCCCC)C(=O)OCCCC |
| InChI | InChI=1S/C37H66N4O13/c1-5-9-20-51-33(44)17-14-29(36(47)53-22-11-7-3)40-31(42)16-13-28(39-32(43)27-50-26-25-49-24-19-38)35(46)41-30(37(48)54-23-12-8-4)15-18-34(45)52-21-10-6-2/h28-30H,5-27,38H2,1-4H3,(H,39,43)(H,40,42)(H,41,46) |
| InChIKey | ALAPXZVJDNDFCL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 236.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.95 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|