C21H29N7O8S — CID 155490101
(2R)-6-amino-2-[[(3R)-3-carboxy-3-[3-[4-(4-sulfamoylphenyl)triazol-1-yl]propanoylamino]propanoyl]amino]hexanoic acid (PubChem CID 155490101) has the molecular formula C21H29N7O8S and a molecular weight of 539.57 g/mol. Its IUPAC name is (2R)-6-amino-2-[[(3R)-3-carboxy-3-[3-[4-(4-sulfamoylphenyl)triazol-1-yl]propanoylamino]propanoyl]amino]hexanoic acid.
| Compound Name | (2R)-6-amino-2-[[(3R)-3-carboxy-3-[3-[4-(4-sulfamoylphenyl)triazol-1-yl]propanoylamino]propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 155490101 |
| Molecular Formula | C21H29N7O8S |
| Molecular Weight | 539.57 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | (2R)-6-amino-2-[[(3R)-3-carboxy-3-[3-[4-(4-sulfamoylphenyl)triazol-1-yl]propanoylamino]propanoyl]amino]hexanoic acid |
| SMILES | NCCCC[C@@H](NC(=O)C[C@@H](NC(=O)CCn1cc(-c2ccc(S(N)(=O)=O)cc2)nn1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C21H29N7O8S/c22-9-2-1-3-15(20(31)32)24-19(30)11-16(21(33)34)25-18(29)8-10-28-12-17(26-27-28)13-4-6-14(7-5-13)37(23,35)36/h4-7,12,15-16H,1-3,8-11,22H2,(H,24,30)(H,25,29)(H,31,32)(H,33,34)(H2,23,35,36)/t15-,16-/m1/s1 |
| InChIKey | NWIBJFRLAYSVNU-HZPDHXFCSA-N |
| XLogP | -1.36 |
| TPSA | 249.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.57 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|