C15H18FN5O3 — CID 175931158
(2S)-6-amino-2-[[4-(4-fluorophenyl)triazole-1-carbonyl]amino]hexanoic acid (PubChem CID 175931158) has the molecular formula C15H18FN5O3 and a molecular weight of 335.34 g/mol. Its IUPAC name is (2S)-6-amino-2-[[4-(4-fluorophenyl)triazole-1-carbonyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[4-(4-fluorophenyl)triazole-1-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 175931158 |
| Molecular Formula | C15H18FN5O3 |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | (2S)-6-amino-2-[[4-(4-fluorophenyl)triazole-1-carbonyl]amino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)n1cc(-c2ccc(F)cc2)nn1)C(=O)O |
| InChI | InChI=1S/C15H18FN5O3/c16-11-6-4-10(5-7-11)13-9-21(20-19-13)15(24)18-12(14(22)23)3-1-2-8-17/h4-7,9,12H,1-3,8,17H2,(H,18,24)(H,22,23)/t12-/m0/s1 |
| InChIKey | RNDIJGKHEMLKAB-LBPRGKRZSA-N |
| XLogP | 1.22 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|