C28H45N7O7S — CID 123803374
6-[[2-[6-[[4-(2-aminopropyl)phenyl]carbamothioylamino]hexanoylamino]-4-carboxybutanoyl]amino]-2-(carbamoylamino)hexanoic acid (PubChem CID 123803374) has the molecular formula C28H45N7O7S and a molecular weight of 623.78 g/mol. Its IUPAC name is 6-[[2-[6-[[4-(2-aminopropyl)phenyl]carbamothioylamino]hexanoylamino]-4-carboxybutanoyl]amino]-2-(carbamoylamino)hexanoic acid.
| Compound Name | 6-[[2-[6-[[4-(2-aminopropyl)phenyl]carbamothioylamino]hexanoylamino]-4-carboxybutanoyl]amino]-2-(carbamoylamino)hexanoic acid |
|---|---|
| PubChem CID | 123803374 |
| Molecular Formula | C28H45N7O7S |
| Molecular Weight | 623.78 g/mol |
| Exact Mass | 623.31 |
| IUPAC Name | 6-[[2-[6-[[4-(2-aminopropyl)phenyl]carbamothioylamino]hexanoylamino]-4-carboxybutanoyl]amino]-2-(carbamoylamino)hexanoic acid |
| SMILES | CC(N)Cc1ccc(NC(=S)NCCCCCC(=O)NC(CCC(=O)O)C(=O)NCCCCC(NC(N)=O)C(=O)O)cc1 |
| InChI | InChI=1S/C28H45N7O7S/c1-18(29)17-19-9-11-20(12-10-19)33-28(43)32-16-5-2-3-8-23(36)34-21(13-14-24(37)38)25(39)31-15-6-4-7-22(26(40)41)35-27(30)42/h9-12,18,21-22H,2-8,13-17,29H2,1H3,(H,31,39)(H,34,36)(H,37,38)(H,40,41)(H3,30,35,42)(H2,32,33,43) |
| InChIKey | JWCVFNSVXZDECM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 238.00 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.78 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|