C32H52N8O9S — CID 138741147
(2S)-6-[[(2S)-2-[6-[[4-[2-amino-3-(ethylamino)propyl]phenyl]carbamothioylamino]hexanoylamino]-4-carboxybutanoyl]amino]-2-(carboxymethylcarbamoylamino)hexanoic acid (PubChem CID 138741147) has the molecular formula C32H52N8O9S and a molecular weight of 724.88 g/mol. Its IUPAC name is (2S)-6-[[(2S)-2-[6-[[4-[2-amino-3-(ethylamino)propyl]phenyl]carbamothioylamino]hexanoylamino]-4-carboxybutanoyl]amino]-2-(carboxymethylcarbamoylamino)hexanoic acid.
| Compound Name | (2S)-6-[[(2S)-2-[6-[[4-[2-amino-3-(ethylamino)propyl]phenyl]carbamothioylamino]hexanoylamino]-4-carboxybutanoyl]amino]-2-(carboxymethylcarbamoylamino)hexanoic acid |
|---|---|
| PubChem CID | 138741147 |
| Molecular Formula | C32H52N8O9S |
| Molecular Weight | 724.88 g/mol |
| Exact Mass | 724.36 |
| IUPAC Name | (2S)-6-[[(2S)-2-[6-[[4-[2-amino-3-(ethylamino)propyl]phenyl]carbamothioylamino]hexanoylamino]-4-carboxybutanoyl]amino]-2-(carboxymethylcarbamoylamino)hexanoic acid |
| SMILES | CCNCC(N)Cc1ccc(NC(=S)NCCCCCC(=O)N[C@@H](CCC(=O)O)C(=O)NCCCC[C@H](NC(=O)NCC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C32H52N8O9S/c1-2-34-19-22(33)18-21-10-12-23(13-11-21)38-32(50)36-17-6-3-4-9-26(41)39-24(14-15-27(42)43)29(46)35-16-7-5-8-25(30(47)48)40-31(49)37-20-28(44)45/h10-13,22,24-25,34H,2-9,14-20,33H2,1H3,(H,35,46)(H,39,41)(H,42,43)(H,44,45)(H,47,48)(H2,36,38,50)(H2,37,40,49)/t22?,24-,25-/m0/s1 |
| InChIKey | YQSWOPATFLLDHN-GARJWBAXSA-N |
| XLogP | 0.49 |
| TPSA | 273.34 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.88 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|