C34H54N6O13 — CID 67144060
2-[[1-carboxy-5-[[8-[[1-carboxy-5-[[3-(carboxymethyl)-3H-pyrrol-2-yl]methyl-methylamino]pentyl]amino]-8-oxooctanoyl]amino]pentyl]carbamoylamino]pentanedioic acid (PubChem CID 67144060) has the molecular formula C34H54N6O13 and a molecular weight of 754.83 g/mol. Its IUPAC name is 2-[[1-carboxy-5-[[8-[[1-carboxy-5-[[3-(carboxymethyl)-3H-pyrrol-2-yl]methyl-methylamino]pentyl]amino]-8-oxooctanoyl]amino]pentyl]carbamoylamino]pentanedioic acid.
| Compound Name | 2-[[1-carboxy-5-[[8-[[1-carboxy-5-[[3-(carboxymethyl)-3H-pyrrol-2-yl]methyl-methylamino]pentyl]amino]-8-oxooctanoyl]amino]pentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 67144060 |
| Molecular Formula | C34H54N6O13 |
| Molecular Weight | 754.83 g/mol |
| Exact Mass | 754.37 |
| IUPAC Name | 2-[[1-carboxy-5-[[8-[[1-carboxy-5-[[3-(carboxymethyl)-3H-pyrrol-2-yl]methyl-methylamino]pentyl]amino]-8-oxooctanoyl]amino]pentyl]carbamoylamino]pentanedioic acid |
| SMILES | CN(CCCCC(NC(=O)CCCCCCC(=O)NCCCCC(NC(=O)NC(CCC(=O)O)C(=O)O)C(=O)O)C(=O)O)CC1=NC=CC1CC(=O)O |
| InChI | InChI=1S/C34H54N6O13/c1-40(21-26-22(16-18-35-26)20-30(45)46)19-9-7-11-23(31(47)48)37-28(42)13-5-3-2-4-12-27(41)36-17-8-6-10-24(32(49)50)38-34(53)39-25(33(51)52)14-15-29(43)44/h16,18,22-25H,2-15,17,19-21H2,1H3,(H,36,41)(H,37,42)(H,43,44)(H,45,46)(H,47,48)(H,49,50)(H,51,52)(H2,38,39,53) |
| InChIKey | PNGJOOPXIBWPBW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 301.43 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.83 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|