C19H30N4O8 — CID 139478746
(2S)-2-[[(1S)-1-carboxy-5-[[(2E,4Z)-hexa-2,4-dien-3-yl]carbamoylamino]pentyl]carbamoylamino]pentanedioic acid (PubChem CID 139478746) has the molecular formula C19H30N4O8 and a molecular weight of 442.47 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-carboxy-5-[[(2E,4Z)-hexa-2,4-dien-3-yl]carbamoylamino]pentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-1-carboxy-5-[[(2E,4Z)-hexa-2,4-dien-3-yl]carbamoylamino]pentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 139478746 |
| Molecular Formula | C19H30N4O8 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | (2S)-2-[[(1S)-1-carboxy-5-[[(2E,4Z)-hexa-2,4-dien-3-yl]carbamoylamino]pentyl]carbamoylamino]pentanedioic acid |
| SMILES | C/C=C\C(=C/C)NC(=O)NCCCC[C@H](NC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C19H30N4O8/c1-3-7-12(4-2)21-18(30)20-11-6-5-8-13(16(26)27)22-19(31)23-14(17(28)29)9-10-15(24)25/h3-4,7,13-14H,5-6,8-11H2,1-2H3,(H,24,25)(H,26,27)(H,28,29)(H2,20,21,30)(H2,22,23,31)/b7-3-,12-4+/t13-,14-/m0/s1 |
| InChIKey | FLEJCQNVOBWXCG-VBYVOWBISA-N |
| XLogP | 1.01 |
| TPSA | 194.16 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|